C22H24FN5 — CID 112891536
4-(4-benzylpiperazin-1-yl)-N-[(4-fluorophenyl)methyl]pyrimidin-2-amine (PubChem CID 112891536) has the molecular formula C22H24FN5 and a molecular weight of 377.47 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-N-[(4-fluorophenyl)methyl]pyrimidin-2-amine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-N-[(4-fluorophenyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 112891536 |
| Molecular Formula | C22H24FN5 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-N-[(4-fluorophenyl)methyl]pyrimidin-2-amine |
| SMILES | Fc1ccc(CNc2nccc(N3CCN(Cc4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C22H24FN5/c23-20-8-6-18(7-9-20)16-25-22-24-11-10-21(26-22)28-14-12-27(13-15-28)17-19-4-2-1-3-5-19/h1-11H,12-17H2,(H,24,25,26) |
| InChIKey | IDVXQSUSCSLGEB-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |