C18H25N5 — CID 112881929
4-(4-benzylpiperazin-1-yl)-N-propylpyrimidin-2-amine (PubChem CID 112881929) has the molecular formula C18H25N5 and a molecular weight of 311.43 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)-N-propylpyrimidin-2-amine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112881929 |
| Molecular Formula | C18H25N5 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1nccc(N2CCN(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C18H25N5/c1-2-9-19-18-20-10-8-17(21-18)23-13-11-22(12-14-23)15-16-6-4-3-5-7-16/h3-8,10H,2,9,11-15H2,1H3,(H,19,20,21) |
| InChIKey | FOGFJDUWIAJQGR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |