C17H25N7 — CID 112898903
N-pentyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112898903) has the molecular formula C17H25N7 and a molecular weight of 327.44 g/mol. Its IUPAC name is N-pentyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-pentyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112898903 |
| Molecular Formula | C17H25N7 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | N-pentyl-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CCCCCNc1nccc(N2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C17H25N7/c1-2-3-4-7-18-16-19-10-6-15(22-16)23-11-13-24(14-12-23)17-20-8-5-9-21-17/h5-6,8-10H,2-4,7,11-14H2,1H3,(H,18,19,22) |
| InChIKey | NMNUCHQLOLRAPP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|