C15H28N6 — CID 80805920
4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-N-propylpyrimidin-2-amine (PubChem CID 80805920) has the molecular formula C15H28N6 and a molecular weight of 292.43 g/mol. Its IUPAC name is 4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-N-propylpyrimidin-2-amine.
| Compound Name | 4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-N-propylpyrimidin-2-amine |
|---|---|
| PubChem CID | 80805920 |
| Molecular Formula | C15H28N6 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 4-[4-[2-(dimethylamino)ethyl]piperazin-1-yl]-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1nccc(N2CCN(CCN(C)C)CC2)n1 |
| InChI | InChI=1S/C15H28N6/c1-4-6-16-15-17-7-5-14(18-15)21-12-10-20(11-13-21)9-8-19(2)3/h5,7H,4,6,8-13H2,1-3H3,(H,16,17,18) |
| InChIKey | QZSQKYMQMQROEH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |