C14H24N6O — CID 66903028
1-[4-[2-[2-(dimethylamino)ethylamino]pyrimidin-4-yl]piperazin-1-yl]ethanone (PubChem CID 66903028) has the molecular formula C14H24N6O and a molecular weight of 292.39 g/mol. Its IUPAC name is 1-[4-[2-[2-(dimethylamino)ethylamino]pyrimidin-4-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[2-(dimethylamino)ethylamino]pyrimidin-4-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 66903028 |
| Molecular Formula | C14H24N6O |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 1-[4-[2-[2-(dimethylamino)ethylamino]pyrimidin-4-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccnc(NCCN(C)C)n2)CC1 |
| InChI | InChI=1S/C14H24N6O/c1-12(21)19-8-10-20(11-9-19)13-4-5-15-14(17-13)16-6-7-18(2)3/h4-5H,6-11H2,1-3H3,(H,15,16,17) |
| InChIKey | WMKJBRNHHWOFMN-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |