C18H25N7O — CID 109252908
[2-[2-(dimethylamino)ethylamino]pyrimidin-5-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 109252908) has the molecular formula C18H25N7O and a molecular weight of 355.45 g/mol. Its IUPAC name is [2-[2-(dimethylamino)ethylamino]pyrimidin-5-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [2-[2-(dimethylamino)ethylamino]pyrimidin-5-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109252908 |
| Molecular Formula | C18H25N7O |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | [2-[2-(dimethylamino)ethylamino]pyrimidin-5-yl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | CN(C)CCNc1ncc(C(=O)N2CCN(c3ccccn3)CC2)cn1 |
| InChI | InChI=1S/C18H25N7O/c1-23(2)8-7-20-18-21-13-15(14-22-18)17(26)25-11-9-24(10-12-25)16-5-3-4-6-19-16/h3-6,13-14H,7-12H2,1-2H3,(H,20,21,22) |
| InChIKey | YZDUVKHLUGDBPT-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |