C19H25N5O4 — CID 112888949
1-[4-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone (PubChem CID 112888949) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 1-[4-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 112888949 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-[4-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]piperazin-1-yl]ethanone |
| SMILES | COc1cc(Nc2nccc(N3CCN(C(C)=O)CC3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H25N5O4/c1-13(25)23-7-9-24(10-8-23)17-5-6-20-19(22-17)21-14-11-15(26-2)18(28-4)16(12-14)27-3/h5-6,11-12H,7-10H2,1-4H3,(H,20,21,22) |
| InChIKey | XEOMTKYDZWNELH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 89.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |