C22H24N4O4 — CID 56968674
1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-7-ol (PubChem CID 56968674) has the molecular formula C22H24N4O4 and a molecular weight of 408.46 g/mol. Its IUPAC name is 1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-7-ol.
| Compound Name | 1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-7-ol |
|---|---|
| PubChem CID | 56968674 |
| Molecular Formula | C22H24N4O4 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 1-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]-3,4-dihydro-2H-quinolin-7-ol |
| SMILES | COc1cc(Nc2nccc(N3CCCc4ccc(O)cc43)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H24N4O4/c1-28-18-11-15(12-19(29-2)21(18)30-3)24-22-23-9-8-20(25-22)26-10-4-5-14-6-7-16(27)13-17(14)26/h6-9,11-13,27H,4-5,10H2,1-3H3,(H,23,24,25) |
| InChIKey | BZBOPWQHENSJJC-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |