C19H19N3O4 — CID 135815278
4-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]phenol (PubChem CID 135815278) has the molecular formula C19H19N3O4 and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]phenol.
| Compound Name | 4-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]phenol |
|---|---|
| PubChem CID | 135815278 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[2-(3,4,5-trimethoxyanilino)pyrimidin-4-yl]phenol |
| SMILES | COc1cc(Nc2nccc(-c3ccc(O)cc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19N3O4/c1-24-16-10-13(11-17(25-2)18(16)26-3)21-19-20-9-8-15(22-19)12-4-6-14(23)7-5-12/h4-11,23H,1-3H3,(H,20,21,22) |
| InChIKey | LFQZTMDDFZMUGL-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 85.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |