C21H19N3O4 — CID 171354201
4-(1-benzofuran-3-yl)-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine (PubChem CID 171354201) has the molecular formula C21H19N3O4 and a molecular weight of 377.40 g/mol. Its IUPAC name is 4-(1-benzofuran-3-yl)-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine.
| Compound Name | 4-(1-benzofuran-3-yl)-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 171354201 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 4-(1-benzofuran-3-yl)-N-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
| SMILES | COc1cc(Nc2nccc(-c3coc4ccccc34)n2)cc(OC)c1OC |
| InChI | InChI=1S/C21H19N3O4/c1-25-18-10-13(11-19(26-2)20(18)27-3)23-21-22-9-8-16(24-21)15-12-28-17-7-5-4-6-14(15)17/h4-12H,1-3H3,(H,22,23,24) |
| InChIKey | HBMHDSQQWLQHNE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |