C21H24N4O3 — CID 112902949
4-N-ethyl-4-N-phenyl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine (PubChem CID 112902949) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-N-ethyl-4-N-phenyl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-ethyl-4-N-phenyl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112902949 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 4-N-ethyl-4-N-phenyl-2-N-(3,4,5-trimethoxyphenyl)pyrimidine-2,4-diamine |
| SMILES | CCN(c1ccccc1)c1ccnc(Nc2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C21H24N4O3/c1-5-25(16-9-7-6-8-10-16)19-11-12-22-21(24-19)23-15-13-17(26-2)20(28-4)18(14-15)27-3/h6-14H,5H2,1-4H3,(H,22,23,24) |
| InChIKey | KYQOXXOXWZDYIY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 68.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |