C18H17BrN4 — CID 112902939
2-N-(2-bromophenyl)-4-N-ethyl-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 112902939) has the molecular formula C18H17BrN4 and a molecular weight of 369.27 g/mol. Its IUPAC name is 2-N-(2-bromophenyl)-4-N-ethyl-4-N-phenylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-bromophenyl)-4-N-ethyl-4-N-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112902939 |
| Molecular Formula | C18H17BrN4 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 2-N-(2-bromophenyl)-4-N-ethyl-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | CCN(c1ccccc1)c1ccnc(Nc2ccccc2Br)n1 |
| InChI | InChI=1S/C18H17BrN4/c1-2-23(14-8-4-3-5-9-14)17-12-13-20-18(22-17)21-16-11-7-6-10-15(16)19/h3-13H,2H2,1H3,(H,20,21,22) |
| InChIKey | KHAKOIRAQKCRRZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |