C15H17BrN4 — CID 112884584
N-(2-bromophenyl)-4-piperidin-1-ylpyrimidin-2-amine (PubChem CID 112884584) has the molecular formula C15H17BrN4 and a molecular weight of 333.23 g/mol. Its IUPAC name is N-(2-bromophenyl)-4-piperidin-1-ylpyrimidin-2-amine.
| Compound Name | N-(2-bromophenyl)-4-piperidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112884584 |
| Molecular Formula | C15H17BrN4 |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 332.06 |
| IUPAC Name | N-(2-bromophenyl)-4-piperidin-1-ylpyrimidin-2-amine |
| SMILES | Brc1ccccc1Nc1nccc(N2CCCCC2)n1 |
| InChI | InChI=1S/C15H17BrN4/c16-12-6-2-3-7-13(12)18-15-17-9-8-14(19-15)20-10-4-1-5-11-20/h2-3,6-9H,1,4-5,10-11H2,(H,17,18,19) |
| InChIKey | YYYCNRGIBKGTCX-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |