C18H18ClN7 — CID 112898936
N-(2-chlorophenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112898936) has the molecular formula C18H18ClN7 and a molecular weight of 367.84 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-(2-chlorophenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112898936 |
| Molecular Formula | C18H18ClN7 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | N-(2-chlorophenyl)-4-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | Clc1ccccc1Nc1nccc(N2CCN(c3ncccn3)CC2)n1 |
| InChI | InChI=1S/C18H18ClN7/c19-14-4-1-2-5-15(14)23-17-20-9-6-16(24-17)25-10-12-26(13-11-25)18-21-7-3-8-22-18/h1-9H,10-13H2,(H,20,23,24) |
| InChIKey | LCSRIEAEPZXRHM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |