C15H17Cl2N5 — CID 112888061
N-(2,5-dichlorophenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112888061) has the molecular formula C15H17Cl2N5 and a molecular weight of 338.24 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-(2,5-dichlorophenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112888061 |
| Molecular Formula | C15H17Cl2N5 |
| Molecular Weight | 338.24 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccnc(Nc3cc(Cl)ccc3Cl)n2)CC1 |
| InChI | InChI=1S/C15H17Cl2N5/c1-21-6-8-22(9-7-21)14-4-5-18-15(20-14)19-13-10-11(16)2-3-12(13)17/h2-5,10H,6-9H2,1H3,(H,18,19,20) |
| InChIKey | BCAFABDXNXHMRQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |