C14H14Cl2N4O — CID 112886524
N-(2,5-dichlorophenyl)-4-morpholin-4-ylpyrimidin-2-amine (PubChem CID 112886524) has the molecular formula C14H14Cl2N4O and a molecular weight of 325.20 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-morpholin-4-ylpyrimidin-2-amine.
| Compound Name | N-(2,5-dichlorophenyl)-4-morpholin-4-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112886524 |
| Molecular Formula | C14H14Cl2N4O |
| Molecular Weight | 325.20 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-morpholin-4-ylpyrimidin-2-amine |
| SMILES | Clc1ccc(Cl)c(Nc2nccc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C14H14Cl2N4O/c15-10-1-2-11(16)12(9-10)18-14-17-4-3-13(19-14)20-5-7-21-8-6-20/h1-4,9H,5-8H2,(H,17,18,19) |
| InChIKey | SJINVNHYTSNCKH-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |