C17H18ClN5O3 — CID 112888629
methyl 4-chloro-3-[[4-(4-formylpiperazin-1-yl)pyrimidin-2-yl]amino]benzoate (PubChem CID 112888629) has the molecular formula C17H18ClN5O3 and a molecular weight of 375.82 g/mol. Its IUPAC name is methyl 4-chloro-3-[[4-(4-formylpiperazin-1-yl)pyrimidin-2-yl]amino]benzoate.
| Compound Name | methyl 4-chloro-3-[[4-(4-formylpiperazin-1-yl)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112888629 |
| Molecular Formula | C17H18ClN5O3 |
| Molecular Weight | 375.82 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | methyl 4-chloro-3-[[4-(4-formylpiperazin-1-yl)pyrimidin-2-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Cl)c(Nc2nccc(N3CCN(C=O)CC3)n2)c1 |
| InChI | InChI=1S/C17H18ClN5O3/c1-26-16(25)12-2-3-13(18)14(10-12)20-17-19-5-4-15(21-17)23-8-6-22(11-24)7-9-23/h2-5,10-11H,6-9H2,1H3,(H,19,20,21) |
| InChIKey | JMHIKYROORTBHF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.82 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|