C11H6Cl2F3N3 — CID 154454877
N-(2,5-dichlorophenyl)-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 154454877) has the molecular formula C11H6Cl2F3N3 and a molecular weight of 308.09 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(2,5-dichlorophenyl)-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 154454877 |
| Molecular Formula | C11H6Cl2F3N3 |
| Molecular Weight | 308.09 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | N-(2,5-dichlorophenyl)-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | FC(F)(F)c1ccnc(Nc2cc(Cl)ccc2Cl)n1 |
| InChI | InChI=1S/C11H6Cl2F3N3/c12-6-1-2-7(13)8(5-6)18-10-17-4-3-9(19-10)11(14,15)16/h1-5H,(H,17,18,19) |
| InChIKey | XFGJYCQSBFGQRP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.09 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |