C16H20ClN5O — CID 112888006
N-(5-chloro-2-methoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 112888006) has the molecular formula C16H20ClN5O and a molecular weight of 333.82 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112888006 |
| Molecular Formula | C16H20ClN5O |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-4-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | COc1ccc(Cl)cc1Nc1nccc(N2CCN(C)CC2)n1 |
| InChI | InChI=1S/C16H20ClN5O/c1-21-7-9-22(10-8-21)15-5-6-18-16(20-15)19-13-11-12(17)3-4-14(13)23-2/h3-6,11H,7-10H2,1-2H3,(H,18,19,20) |
| InChIKey | VJDJHYPDQWNJFK-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |