C17H20ClN5O2 — CID 109253752
[2-(5-chloro-2-methoxyanilino)pyrimidin-5-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 109253752) has the molecular formula C17H20ClN5O2 and a molecular weight of 361.83 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)pyrimidin-5-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [2-(5-chloro-2-methoxyanilino)pyrimidin-5-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 109253752 |
| Molecular Formula | C17H20ClN5O2 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)pyrimidin-5-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | COc1ccc(Cl)cc1Nc1ncc(C(=O)N2CCN(C)CC2)cn1 |
| InChI | InChI=1S/C17H20ClN5O2/c1-22-5-7-23(8-6-22)16(24)12-10-19-17(20-11-12)21-14-9-13(18)3-4-15(14)25-2/h3-4,9-11H,5-8H2,1-2H3,(H,19,20,21) |
| InChIKey | LFNXULCEYHDOJR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |