C18H20ClN5O2 — CID 109254686
1-[4-[2-(4-chloro-2-methylanilino)pyrimidine-5-carbonyl]piperazin-1-yl]ethanone (PubChem CID 109254686) has the molecular formula C18H20ClN5O2 and a molecular weight of 373.84 g/mol. Its IUPAC name is 1-[4-[2-(4-chloro-2-methylanilino)pyrimidine-5-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-(4-chloro-2-methylanilino)pyrimidine-5-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 109254686 |
| Molecular Formula | C18H20ClN5O2 |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 1-[4-[2-(4-chloro-2-methylanilino)pyrimidine-5-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2cnc(Nc3ccc(Cl)cc3C)nc2)CC1 |
| InChI | InChI=1S/C18H20ClN5O2/c1-12-9-15(19)3-4-16(12)22-18-20-10-14(11-21-18)17(26)24-7-5-23(6-8-24)13(2)25/h3-4,9-11H,5-8H2,1-2H3,(H,20,21,22) |
| InChIKey | XXMXJLMOCUITCR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |