C11H11ClN4 — CID 82290977
2-N-(4-chloro-2-methylphenyl)pyrimidine-2,5-diamine (PubChem CID 82290977) has the molecular formula C11H11ClN4 and a molecular weight of 234.69 g/mol. Its IUPAC name is 2-N-(4-chloro-2-methylphenyl)pyrimidine-2,5-diamine.
| Compound Name | 2-N-(4-chloro-2-methylphenyl)pyrimidine-2,5-diamine |
|---|---|
| PubChem CID | 82290977 |
| Molecular Formula | C11H11ClN4 |
| Molecular Weight | 234.69 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-N-(4-chloro-2-methylphenyl)pyrimidine-2,5-diamine |
| SMILES | Cc1cc(Cl)ccc1Nc1ncc(N)cn1 |
| InChI | InChI=1S/C11H11ClN4/c1-7-4-8(12)2-3-10(7)16-11-14-5-9(13)6-15-11/h2-6H,13H2,1H3,(H,14,15,16) |
| InChIKey | PFQIZBHXNGADPG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.69 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |