C19H22ClN5O2 — CID 109254653
1-[4-[2-[2-(3-chlorophenyl)ethylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone (PubChem CID 109254653) has the molecular formula C19H22ClN5O2 and a molecular weight of 387.87 g/mol. Its IUPAC name is 1-[4-[2-[2-(3-chlorophenyl)ethylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[2-(3-chlorophenyl)ethylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 109254653 |
| Molecular Formula | C19H22ClN5O2 |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 1-[4-[2-[2-(3-chlorophenyl)ethylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2cnc(NCCc3cccc(Cl)c3)nc2)CC1 |
| InChI | InChI=1S/C19H22ClN5O2/c1-14(26)24-7-9-25(10-8-24)18(27)16-12-22-19(23-13-16)21-6-5-15-3-2-4-17(20)11-15/h2-4,11-13H,5-10H2,1H3,(H,21,22,23) |
| InChIKey | LCPWZEVAEBZHJO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |