C19H22FN5O2 — CID 109254624
1-[4-[2-[2-(2-fluorophenyl)ethylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone (PubChem CID 109254624) has the molecular formula C19H22FN5O2 and a molecular weight of 371.42 g/mol. Its IUPAC name is 1-[4-[2-[2-(2-fluorophenyl)ethylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[2-(2-fluorophenyl)ethylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 109254624 |
| Molecular Formula | C19H22FN5O2 |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-[4-[2-[2-(2-fluorophenyl)ethylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2cnc(NCCc3ccccc3F)nc2)CC1 |
| InChI | InChI=1S/C19H22FN5O2/c1-14(26)24-8-10-25(11-9-24)18(27)16-12-22-19(23-13-16)21-7-6-15-4-2-3-5-17(15)20/h2-5,12-13H,6-11H2,1H3,(H,21,22,23) |
| InChIKey | BKALRZFWCPOJCO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |