C18H20FN5O2 — CID 109254612
1-[4-[2-[(4-fluorophenyl)methylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone (PubChem CID 109254612) has the molecular formula C18H20FN5O2 and a molecular weight of 357.39 g/mol. Its IUPAC name is 1-[4-[2-[(4-fluorophenyl)methylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[2-[(4-fluorophenyl)methylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 109254612 |
| Molecular Formula | C18H20FN5O2 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-[4-[2-[(4-fluorophenyl)methylamino]pyrimidine-5-carbonyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2cnc(NCc3ccc(F)cc3)nc2)CC1 |
| InChI | InChI=1S/C18H20FN5O2/c1-13(25)23-6-8-24(9-7-23)17(26)15-11-21-18(22-12-15)20-10-14-2-4-16(19)5-3-14/h2-5,11-12H,6-10H2,1H3,(H,20,21,22) |
| InChIKey | NUEZGLPQIUKMGS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |