C19H26ClN3O3 — CID 108961228
3-(4-acetylpiperazin-1-yl)-N-[2-(3-chlorophenyl)ethyl]-2,2-dimethyl-3-oxopropanamide (PubChem CID 108961228) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is 3-(4-acetylpiperazin-1-yl)-N-[2-(3-chlorophenyl)ethyl]-2,2-dimethyl-3-oxopropanamide.
| Compound Name | 3-(4-acetylpiperazin-1-yl)-N-[2-(3-chlorophenyl)ethyl]-2,2-dimethyl-3-oxopropanamide |
|---|---|
| PubChem CID | 108961228 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 3-(4-acetylpiperazin-1-yl)-N-[2-(3-chlorophenyl)ethyl]-2,2-dimethyl-3-oxopropanamide |
| SMILES | CC(=O)N1CCN(C(=O)C(C)(C)C(=O)NCCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C19H26ClN3O3/c1-14(24)22-9-11-23(12-10-22)18(26)19(2,3)17(25)21-8-7-15-5-4-6-16(20)13-15/h4-6,13H,7-12H2,1-3H3,(H,21,25) |
| InChIKey | RSRXMSLMZMFFBS-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|