C20H22Cl2N2O2 — CID 108966968
N-(5-chloro-2-methylphenyl)-N'-[2-(3-chlorophenyl)ethyl]-2,2-dimethylpropanediamide (PubChem CID 108966968) has the molecular formula C20H22Cl2N2O2 and a molecular weight of 393.31 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-N'-[2-(3-chlorophenyl)ethyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-N'-[2-(3-chlorophenyl)ethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108966968 |
| Molecular Formula | C20H22Cl2N2O2 |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-N'-[2-(3-chlorophenyl)ethyl]-2,2-dimethylpropanediamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)C(C)(C)C(=O)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N2O2/c1-13-7-8-16(22)12-17(13)24-19(26)20(2,3)18(25)23-10-9-14-5-4-6-15(21)11-14/h4-8,11-12H,9-10H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | SYOMKYUDDZHDOF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|