C17H17ClN2O2 — CID 108986517
N-[2-(3-chlorophenyl)ethyl]-N'-(2-methylphenyl)oxamide (PubChem CID 108986517) has the molecular formula C17H17ClN2O2 and a molecular weight of 316.79 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N'-(2-methylphenyl)oxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N'-(2-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108986517 |
| Molecular Formula | C17H17ClN2O2 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N'-(2-methylphenyl)oxamide |
| SMILES | Cc1ccccc1NC(=O)C(=O)NCCc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H17ClN2O2/c1-12-5-2-3-8-15(12)20-17(22)16(21)19-10-9-13-6-4-7-14(18)11-13/h2-8,11H,9-10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | GSONRJMOXABKNC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|