C20H24ClN3O2 — CID 108986567
N-[2-(3-chlorophenyl)ethyl]-N'-[4-(diethylamino)phenyl]oxamide (PubChem CID 108986567) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N'-[4-(diethylamino)phenyl]oxamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N'-[4-(diethylamino)phenyl]oxamide |
|---|---|
| PubChem CID | 108986567 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N'-[4-(diethylamino)phenyl]oxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(=O)NCCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-3-24(4-2)18-10-8-17(9-11-18)23-20(26)19(25)22-13-12-15-6-5-7-16(21)14-15/h5-11,14H,3-4,12-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | TVEACLQXRCVXOR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|