C20H22ClFN2O2 — CID 108962427
N-[2-(3-chlorophenyl)ethyl]-N'-[(2-fluorophenyl)methyl]-2,2-dimethylpropanediamide (PubChem CID 108962427) has the molecular formula C20H22ClFN2O2 and a molecular weight of 376.86 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)ethyl]-N'-[(2-fluorophenyl)methyl]-2,2-dimethylpropanediamide.
| Compound Name | N-[2-(3-chlorophenyl)ethyl]-N'-[(2-fluorophenyl)methyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108962427 |
| Molecular Formula | C20H22ClFN2O2 |
| Molecular Weight | 376.86 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | N-[2-(3-chlorophenyl)ethyl]-N'-[(2-fluorophenyl)methyl]-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NCCc1cccc(Cl)c1)C(=O)NCc1ccccc1F |
| InChI | InChI=1S/C20H22ClFN2O2/c1-20(2,19(26)24-13-15-7-3-4-9-17(15)22)18(25)23-11-10-14-6-5-8-16(21)12-14/h3-9,12H,10-11,13H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | RVWQAXCQQUZQLW-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.86 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|