C19H20Cl2N2O2 — CID 108963909
N-(2,4-dichlorophenyl)-2,2-dimethyl-N'-(2-phenylethyl)propanediamide (PubChem CID 108963909) has the molecular formula C19H20Cl2N2O2 and a molecular weight of 379.29 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2,2-dimethyl-N'-(2-phenylethyl)propanediamide.
| Compound Name | N-(2,4-dichlorophenyl)-2,2-dimethyl-N'-(2-phenylethyl)propanediamide |
|---|---|
| PubChem CID | 108963909 |
| Molecular Formula | C19H20Cl2N2O2 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2,2-dimethyl-N'-(2-phenylethyl)propanediamide |
| SMILES | CC(C)(C(=O)NCCc1ccccc1)C(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O2/c1-19(2,17(24)22-11-10-13-6-4-3-5-7-13)18(25)23-16-9-8-14(20)12-15(16)21/h3-9,12H,10-11H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | IDKGXEDAOAVIAF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|