C22H27ClN2O2 — CID 108965035
N-[2-(4-chlorophenyl)ethyl]-2,2-dimethyl-N'-(3-phenylpropyl)propanediamide (PubChem CID 108965035) has the molecular formula C22H27ClN2O2 and a molecular weight of 386.92 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-2,2-dimethyl-N'-(3-phenylpropyl)propanediamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-2,2-dimethyl-N'-(3-phenylpropyl)propanediamide |
|---|---|
| PubChem CID | 108965035 |
| Molecular Formula | C22H27ClN2O2 |
| Molecular Weight | 386.92 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-2,2-dimethyl-N'-(3-phenylpropyl)propanediamide |
| SMILES | CC(C)(C(=O)NCCCc1ccccc1)C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H27ClN2O2/c1-22(2,20(26)24-15-6-9-17-7-4-3-5-8-17)21(27)25-16-14-18-10-12-19(23)13-11-18/h3-5,7-8,10-13H,6,9,14-16H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | WGWGAFRZHWHWHF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.92 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|