C21H25ClN2O2 — CID 108962265
N-benzyl-N'-[2-(4-chlorophenyl)ethyl]-N,2,2-trimethylpropanediamide (PubChem CID 108962265) has the molecular formula C21H25ClN2O2 and a molecular weight of 372.90 g/mol. Its IUPAC name is N-benzyl-N'-[2-(4-chlorophenyl)ethyl]-N,2,2-trimethylpropanediamide.
| Compound Name | N-benzyl-N'-[2-(4-chlorophenyl)ethyl]-N,2,2-trimethylpropanediamide |
|---|---|
| PubChem CID | 108962265 |
| Molecular Formula | C21H25ClN2O2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-benzyl-N'-[2-(4-chlorophenyl)ethyl]-N,2,2-trimethylpropanediamide |
| SMILES | CN(Cc1ccccc1)C(=O)C(C)(C)C(=O)NCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H25ClN2O2/c1-21(2,20(26)24(3)15-17-7-5-4-6-8-17)19(25)23-14-13-16-9-11-18(22)12-10-16/h4-12H,13-15H2,1-3H3,(H,23,25) |
| InChIKey | VDAJNAFPMDZKFC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|