C20H23FN2O2 — CID 108964180
N-[2-(4-fluorophenyl)ethyl]-N',2,2-trimethyl-N'-phenylpropanediamide (PubChem CID 108964180) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-N',2,2-trimethyl-N'-phenylpropanediamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-N',2,2-trimethyl-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 108964180 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-N',2,2-trimethyl-N'-phenylpropanediamide |
| SMILES | CN(C(=O)C(C)(C)C(=O)NCCc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H23FN2O2/c1-20(2,19(25)23(3)17-7-5-4-6-8-17)18(24)22-14-13-15-9-11-16(21)12-10-15/h4-12H,13-14H2,1-3H3,(H,22,24) |
| InChIKey | JRMWZGLZQJCENI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|