C15H23FN2O — CID 65265022
3-amino-N-[2-(4-fluorophenyl)ethyl]-2,2,3-trimethylbutanamide (PubChem CID 65265022) has the molecular formula C15H23FN2O and a molecular weight of 266.36 g/mol. Its IUPAC name is 3-amino-N-[2-(4-fluorophenyl)ethyl]-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-[2-(4-fluorophenyl)ethyl]-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 65265022 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 3-amino-N-[2-(4-fluorophenyl)ethyl]-2,2,3-trimethylbutanamide |
| SMILES | CC(C)(N)C(C)(C)C(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C15H23FN2O/c1-14(2,15(3,4)17)13(19)18-10-9-11-5-7-12(16)8-6-11/h5-8H,9-10,17H2,1-4H3,(H,18,19) |
| InChIKey | XPIXXKPTQMAZAN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |