C18H23ClN4O — CID 112910788
N-(5-chloro-2-methoxyphenyl)-4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-amine (PubChem CID 112910788) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-amine.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112910788 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-4-methyl-6-(4-methylpiperidin-1-yl)pyrimidin-2-amine |
| SMILES | COc1ccc(Cl)cc1Nc1nc(C)cc(N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C18H23ClN4O/c1-12-6-8-23(9-7-12)17-10-13(2)20-18(22-17)21-15-11-14(19)4-5-16(15)24-3/h4-5,10-12H,6-9H2,1-3H3,(H,20,21,22) |
| InChIKey | VESIYHYMCKRQMS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |