C18H23ClN4 — CID 112926082
N-(5-chloro-2-methylphenyl)-4-methyl-6-(3-methylpiperidin-1-yl)pyrimidin-2-amine (PubChem CID 112926082) has the molecular formula C18H23ClN4 and a molecular weight of 330.86 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-4-methyl-6-(3-methylpiperidin-1-yl)pyrimidin-2-amine.
| Compound Name | N-(5-chloro-2-methylphenyl)-4-methyl-6-(3-methylpiperidin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112926082 |
| Molecular Formula | C18H23ClN4 |
| Molecular Weight | 330.86 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-4-methyl-6-(3-methylpiperidin-1-yl)pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCCC(C)C2)nc(Nc2cc(Cl)ccc2C)n1 |
| InChI | InChI=1S/C18H23ClN4/c1-12-5-4-8-23(11-12)17-9-14(3)20-18(22-17)21-16-10-15(19)7-6-13(16)2/h6-7,9-10,12H,4-5,8,11H2,1-3H3,(H,20,21,22) |
| InChIKey | HRNXNCBZIKDQKW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.86 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |