C15H18BrN5 — CID 112961320
5-(azepan-1-yl)-N-(2-bromophenyl)-1,2,4-triazin-3-amine (PubChem CID 112961320) has the molecular formula C15H18BrN5 and a molecular weight of 348.25 g/mol. Its IUPAC name is 5-(azepan-1-yl)-N-(2-bromophenyl)-1,2,4-triazin-3-amine.
| Compound Name | 5-(azepan-1-yl)-N-(2-bromophenyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 112961320 |
| Molecular Formula | C15H18BrN5 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 5-(azepan-1-yl)-N-(2-bromophenyl)-1,2,4-triazin-3-amine |
| SMILES | Brc1ccccc1Nc1nncc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C15H18BrN5/c16-12-7-3-4-8-13(12)18-15-19-14(11-17-20-15)21-9-5-1-2-6-10-21/h3-4,7-8,11H,1-2,5-6,9-10H2,(H,18,19,20) |
| InChIKey | HSXVHCHQSSEWDP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |