C16H18N6 — CID 112961346
2-[[5-(azepan-1-yl)-1,2,4-triazin-3-yl]amino]benzonitrile (PubChem CID 112961346) has the molecular formula C16H18N6 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-[[5-(azepan-1-yl)-1,2,4-triazin-3-yl]amino]benzonitrile.
| Compound Name | 2-[[5-(azepan-1-yl)-1,2,4-triazin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112961346 |
| Molecular Formula | C16H18N6 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 2-[[5-(azepan-1-yl)-1,2,4-triazin-3-yl]amino]benzonitrile |
| SMILES | N#Cc1ccccc1Nc1nncc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C16H18N6/c17-11-13-7-3-4-8-14(13)19-16-20-15(12-18-21-16)22-9-5-1-2-6-10-22/h3-4,7-8,12H,1-2,5-6,9-10H2,(H,19,20,21) |
| InChIKey | QJGBJWUAYMDQSG-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 77.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |