C16H12N6 — CID 112961729
2-[(3-anilino-1,2,4-triazin-5-yl)amino]benzonitrile (PubChem CID 112961729) has the molecular formula C16H12N6 and a molecular weight of 288.31 g/mol. Its IUPAC name is 2-[(3-anilino-1,2,4-triazin-5-yl)amino]benzonitrile.
| Compound Name | 2-[(3-anilino-1,2,4-triazin-5-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 112961729 |
| Molecular Formula | C16H12N6 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | 2-[(3-anilino-1,2,4-triazin-5-yl)amino]benzonitrile |
| SMILES | N#Cc1ccccc1Nc1cnnc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C16H12N6/c17-10-12-6-4-5-9-14(12)20-15-11-18-22-16(21-15)19-13-7-2-1-3-8-13/h1-9,11H,(H2,19,20,21,22) |
| InChIKey | QZBNUGQQGZKBRZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |