C13H14N6 — CID 112938680
2-[[3-(propylamino)-1,2,4-triazin-5-yl]amino]benzonitrile (PubChem CID 112938680) has the molecular formula C13H14N6 and a molecular weight of 254.30 g/mol. Its IUPAC name is 2-[[3-(propylamino)-1,2,4-triazin-5-yl]amino]benzonitrile.
| Compound Name | 2-[[3-(propylamino)-1,2,4-triazin-5-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112938680 |
| Molecular Formula | C13H14N6 |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-[[3-(propylamino)-1,2,4-triazin-5-yl]amino]benzonitrile |
| SMILES | CCCNc1nncc(Nc2ccccc2C#N)n1 |
| InChI | InChI=1S/C13H14N6/c1-2-7-15-13-18-12(9-16-19-13)17-11-6-4-3-5-10(11)8-14/h3-6,9H,2,7H2,1H3,(H2,15,17,18,19) |
| InChIKey | NQLNOYAXGLAMBC-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |