C14H16N6 — CID 80760760
2-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 80760760) has the molecular formula C14H16N6 and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 2-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 80760760 |
| Molecular Formula | C14H16N6 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[[2-amino-6-(propylamino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | CCCNc1cc(Nc2ccccc2C#N)nc(N)n1 |
| InChI | InChI=1S/C14H16N6/c1-2-7-17-12-8-13(20-14(16)19-12)18-11-6-4-3-5-10(11)9-15/h3-6,8H,2,7H2,1H3,(H4,16,17,18,19,20) |
| InChIKey | DNJLPZSFJLEOMC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 99.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |