C17H21N5 — CID 112925575
2-[[6-methyl-2-(pentylamino)pyrimidin-4-yl]amino]benzonitrile (PubChem CID 112925575) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 2-[[6-methyl-2-(pentylamino)pyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 2-[[6-methyl-2-(pentylamino)pyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112925575 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 2-[[6-methyl-2-(pentylamino)pyrimidin-4-yl]amino]benzonitrile |
| SMILES | CCCCCNc1nc(C)cc(Nc2ccccc2C#N)n1 |
| InChI | InChI=1S/C17H21N5/c1-3-4-7-10-19-17-20-13(2)11-16(22-17)21-15-9-6-5-8-14(15)12-18/h5-6,8-9,11H,3-4,7,10H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | JHDRISIFRBGHKJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|