C19H14N6 — CID 112932302
2-[[2-(2-cyanoanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112932302) has the molecular formula C19H14N6 and a molecular weight of 326.36 g/mol. Its IUPAC name is 2-[[2-(2-cyanoanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 2-[[2-(2-cyanoanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112932302 |
| Molecular Formula | C19H14N6 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-[[2-(2-cyanoanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | Cc1cc(Nc2ccccc2C#N)nc(Nc2ccccc2C#N)n1 |
| InChI | InChI=1S/C19H14N6/c1-13-10-18(23-16-8-4-2-6-14(16)11-20)25-19(22-13)24-17-9-5-3-7-15(17)12-21/h2-10H,1H3,(H2,22,23,24,25) |
| InChIKey | XBLLSNAHNDPUKT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |