C20H18N6O — CID 112931566
N-[4-[[4-(2-cyanoanilino)-6-methylpyrimidin-2-yl]amino]phenyl]acetamide (PubChem CID 112931566) has the molecular formula C20H18N6O and a molecular weight of 358.41 g/mol. Its IUPAC name is N-[4-[[4-(2-cyanoanilino)-6-methylpyrimidin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[4-(2-cyanoanilino)-6-methylpyrimidin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 112931566 |
| Molecular Formula | C20H18N6O |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N-[4-[[4-(2-cyanoanilino)-6-methylpyrimidin-2-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2nc(C)cc(Nc3ccccc3C#N)n2)cc1 |
| InChI | InChI=1S/C20H18N6O/c1-13-11-19(25-18-6-4-3-5-15(18)12-21)26-20(22-13)24-17-9-7-16(8-10-17)23-14(2)27/h3-11H,1-2H3,(H,23,27)(H2,22,24,25,26) |
| InChIKey | NFUPURQNRYQTTB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |