C22H24N6 — CID 112931745
2-[[4-[4-(diethylamino)anilino]-6-methylpyrimidin-2-yl]amino]benzonitrile (PubChem CID 112931745) has the molecular formula C22H24N6 and a molecular weight of 372.48 g/mol. Its IUPAC name is 2-[[4-[4-(diethylamino)anilino]-6-methylpyrimidin-2-yl]amino]benzonitrile.
| Compound Name | 2-[[4-[4-(diethylamino)anilino]-6-methylpyrimidin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112931745 |
| Molecular Formula | C22H24N6 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 2-[[4-[4-(diethylamino)anilino]-6-methylpyrimidin-2-yl]amino]benzonitrile |
| SMILES | CCN(CC)c1ccc(Nc2cc(C)nc(Nc3ccccc3C#N)n2)cc1 |
| InChI | InChI=1S/C22H24N6/c1-4-28(5-2)19-12-10-18(11-13-19)25-21-14-16(3)24-22(27-21)26-20-9-7-6-8-17(20)15-23/h6-14H,4-5H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | GQOPRTAVVSYEEI-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|