C19H17N5O — CID 112930539
2-[[2-(2-methoxyanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile (PubChem CID 112930539) has the molecular formula C19H17N5O and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-[[2-(2-methoxyanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile.
| Compound Name | 2-[[2-(2-methoxyanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112930539 |
| Molecular Formula | C19H17N5O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 2-[[2-(2-methoxyanilino)-6-methylpyrimidin-4-yl]amino]benzonitrile |
| SMILES | COc1ccccc1Nc1nc(C)cc(Nc2ccccc2C#N)n1 |
| InChI | InChI=1S/C19H17N5O/c1-13-11-18(22-15-8-4-3-7-14(15)12-20)24-19(21-13)23-16-9-5-6-10-17(16)25-2/h3-11H,1-2H3,(H2,21,22,23,24) |
| InChIKey | VEZIBNGWWWOVNV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |