C13H15BrFN5 — CID 80787761
4-N-(5-bromo-2-fluorophenyl)-6-N-propylpyrimidine-2,4,6-triamine (PubChem CID 80787761) has the molecular formula C13H15BrFN5 and a molecular weight of 340.20 g/mol. Its IUPAC name is 4-N-(5-bromo-2-fluorophenyl)-6-N-propylpyrimidine-2,4,6-triamine.
| Compound Name | 4-N-(5-bromo-2-fluorophenyl)-6-N-propylpyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 80787761 |
| Molecular Formula | C13H15BrFN5 |
| Molecular Weight | 340.20 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 4-N-(5-bromo-2-fluorophenyl)-6-N-propylpyrimidine-2,4,6-triamine |
| SMILES | CCCNc1cc(Nc2cc(Br)ccc2F)nc(N)n1 |
| InChI | InChI=1S/C13H15BrFN5/c1-2-5-17-11-7-12(20-13(16)19-11)18-10-6-8(14)3-4-9(10)15/h3-4,6-7H,2,5H2,1H3,(H4,16,17,18,19,20) |
| InChIKey | YUCIAQFKWODHBW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |