C18H16N6 — CID 112963550
2-[[5-(3,5-dimethylanilino)-1,2,4-triazin-3-yl]amino]benzonitrile (PubChem CID 112963550) has the molecular formula C18H16N6 and a molecular weight of 316.37 g/mol. Its IUPAC name is 2-[[5-(3,5-dimethylanilino)-1,2,4-triazin-3-yl]amino]benzonitrile.
| Compound Name | 2-[[5-(3,5-dimethylanilino)-1,2,4-triazin-3-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112963550 |
| Molecular Formula | C18H16N6 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-[[5-(3,5-dimethylanilino)-1,2,4-triazin-3-yl]amino]benzonitrile |
| SMILES | Cc1cc(C)cc(Nc2cnnc(Nc3ccccc3C#N)n2)c1 |
| InChI | InChI=1S/C18H16N6/c1-12-7-13(2)9-15(8-12)21-17-11-20-24-18(23-17)22-16-6-4-3-5-14(16)10-19/h3-9,11H,1-2H3,(H2,21,22,23,24) |
| InChIKey | LFOOYYDOPFBLIN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |