C16H11ClN6 — CID 112965838
2-[[3-(2-chloroanilino)-1,2,4-triazin-5-yl]amino]benzonitrile (PubChem CID 112965838) has the molecular formula C16H11ClN6 and a molecular weight of 322.76 g/mol. Its IUPAC name is 2-[[3-(2-chloroanilino)-1,2,4-triazin-5-yl]amino]benzonitrile.
| Compound Name | 2-[[3-(2-chloroanilino)-1,2,4-triazin-5-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 112965838 |
| Molecular Formula | C16H11ClN6 |
| Molecular Weight | 322.76 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 2-[[3-(2-chloroanilino)-1,2,4-triazin-5-yl]amino]benzonitrile |
| SMILES | N#Cc1ccccc1Nc1cnnc(Nc2ccccc2Cl)n1 |
| InChI | InChI=1S/C16H11ClN6/c17-12-6-2-4-8-14(12)21-16-22-15(10-19-23-16)20-13-7-3-1-5-11(13)9-18/h1-8,10H,(H2,20,21,22,23) |
| InChIKey | KNIWUBOUWMAIGM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.76 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |